![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/hand.right.gif){kind=icon}
iat: iat (Iso9660 Analyzer Tool) iat: iat: Iso9660 Analyzer Tool is a tool for detecting the structure of many iat: types of CD/DVD image. iat: With Iso9660 Analyzer Tool you can: iat: * Create Cuesheet file from image CD/DVD iat: * Create TOC file from image CD/DVD iat: * Convert image CD/DVD to ISO9660 iat: * Debug image iat: iat: iat home: http://iat.berlios.de/
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| pkg64/ | 02-Feb-2022 13:01 | - | |
| pkg/ | 02-Feb-2022 13:01 | - | |
| build/ | 05-Oct-2015 02:51 | - | |
| README | 07-Apr-2010 00:50 | 368 | |